About ethane;N-methylacetamide;naphthalene
ethane;N-methylacetamide;naphthalene (PubChem CID 91213695) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is ethane;N-methylacetamide;naphthalene.
Molecular Properties
| Compound Name | ethane;N-methylacetamide;naphthalene |
| PubChem CID | 91213695 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | ethane;N-methylacetamide;naphthalene |
| SMILES | CC.CC.CNC(C)=O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C3H7NO.2C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;1-3(5)4-2;2*1-2/h1-8H;1-2H3,(H,4,5);2*1-2H3 |
| InChIKey | YTZJFYWXKMGCIS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;N-methylacetamide;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methylacetamide;naphthalene?
The IUPAC name of ethane;N-methylacetamide;naphthalene (CID 91213695) is ethane;N-methylacetamide;naphthalene.
What is the SMILES notation for ethane;N-methylacetamide;naphthalene?
The canonical SMILES for ethane;N-methylacetamide;naphthalene is CC.CC.CNC(C)=O.c1ccc2ccccc2c1.
What is the InChIKey of ethane;N-methylacetamide;naphthalene?
The InChIKey is YTZJFYWXKMGCIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C3H7NO.2C2H6/c1-2-6-10-8-4-3-7-9(10)5-1;1-3(5)4-2;2*1-2/h1-8H;1-2H3,(H,4,5);2*1-2H3.
What are the key properties of ethane;N-methylacetamide;naphthalene?
ethane;N-methylacetamide;naphthalene has a molecular weight of 261.41 g/mol, XLogP of 4.64, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methylacetamide;naphthalene is sourced from PubChem (CID 91213695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).