C29H43NO4 — CID 118087882
2,5,7,8-tetramethyl-2-[(3E,7Z)-4,8,12-trimethyl-7-nitrotrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol (PubChem CID 118087882) has the molecular formula C29H43NO4 and a molecular weight of 469.67 g/mol. Its IUPAC name is 2,5,7,8-tetramethyl-2-[(3E,7Z)-4,8,12-trimethyl-7-nitrotrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol.
| Compound Name | 2,5,7,8-tetramethyl-2-[(3E,7Z)-4,8,12-trimethyl-7-nitrotrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 118087882 |
| Molecular Formula | C29H43NO4 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | 2,5,7,8-tetramethyl-2-[(3E,7Z)-4,8,12-trimethyl-7-nitrotrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol |
| SMILES | CC(C)=CCC/C(C)=C(/CC/C(C)=C/CCC1(C)CCc2c(C)c(O)c(C)c(C)c2O1)[N+](=O)[O-] |
| InChI | InChI=1S/C29H43NO4/c1-19(2)11-9-13-21(4)26(30(32)33)15-14-20(3)12-10-17-29(8)18-16-25-24(7)27(31)22(5)23(6)28(25)34-29/h11-12,31H,9-10,13-18H2,1-8H3/b20-12+,26-21- |
| InChIKey | BZKXUFIWXQMMIL-NCNBEYAWSA-N |
| XLogP | 8.20 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|