C21H30O4 — CID 10247051
ethyl (E)-5-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2-methylpent-2-enoate (PubChem CID 10247051) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is ethyl (E)-5-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2-methylpent-2-enoate.
| Compound Name | ethyl (E)-5-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 10247051 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | ethyl (E)-5-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-2-methylpent-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CCC1(C)CCc2c(C)c(O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C21H30O4/c1-7-24-20(23)13(2)9-8-11-21(6)12-10-17-16(5)18(22)14(3)15(4)19(17)25-21/h9,22H,7-8,10-12H2,1-6H3/b13-9+ |
| InChIKey | HMCQCVJTHLKUEG-UKTHLTGXSA-N |
| XLogP | 4.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|