C42H58O4 — CID 162850080
3-[2,3-dihydroxy-5-[(3S)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]phenyl]-5-[(3R)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]benzene-1,2-diol (PubChem CID 162850080) has the molecular formula C42H58O4 and a molecular weight of 626.92 g/mol. Its IUPAC name is 3-[2,3-dihydroxy-5-[(3S)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]phenyl]-5-[(3R)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]benzene-1,2-diol.
| Compound Name | 3-[2,3-dihydroxy-5-[(3S)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]phenyl]-5-[(3R)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 162850080 |
| Molecular Formula | C42H58O4 |
| Molecular Weight | 626.92 g/mol |
| Exact Mass | 626.43 |
| IUPAC Name | 3-[2,3-dihydroxy-5-[(3S)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]phenyl]-5-[(3R)-3,7,11-trimethyldodeca-1,6,10-trien-3-yl]benzene-1,2-diol |
| SMILES | C=C[C@@](C)(CCC=C(C)CCC=C(C)C)c1cc(O)c(O)c(-c2cc([C@](C)(C=C)CCC=C(C)CCC=C(C)C)cc(O)c2O)c1 |
| InChI | InChI=1S/C42H58O4/c1-11-41(9,23-15-21-31(7)19-13-17-29(3)4)33-25-35(39(45)37(43)27-33)36-26-34(28-38(44)40(36)46)42(10,12-2)24-16-22-32(8)20-14-18-30(5)6/h11-12,17-18,21-22,25-28,43-46H,1-2,13-16,19-20,23-24H2,3-10H3/t41-,42+ |
| InChIKey | FBBLBOYXADGJGC-ZRKBJOGQSA-N |
| XLogP | 12.01 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.92 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|