C30H45ClO — CID 143532772
2-[(6E,10E)-3-chloro-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-3,5,6-trimethyl-4-methylidenecyclohexa-2,5-dien-1-one (PubChem CID 143532772) has the molecular formula C30H45ClO and a molecular weight of 457.14 g/mol. Its IUPAC name is 2-[(6E,10E)-3-chloro-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-3,5,6-trimethyl-4-methylidenecyclohexa-2,5-dien-1-one.
| Compound Name | 2-[(6E,10E)-3-chloro-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-3,5,6-trimethyl-4-methylidenecyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 143532772 |
| Molecular Formula | C30H45ClO |
| Molecular Weight | 457.14 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 2-[(6E,10E)-3-chloro-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-3,5,6-trimethyl-4-methylidenecyclohexa-2,5-dien-1-one |
| SMILES | C=C1C(C)=C(C)C(=O)C(CCC(C)(Cl)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)=C1C |
| InChI | InChI=1S/C30H45ClO/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-30(9,31)20-18-28-26(7)24(5)25(6)27(8)29(28)32/h13,15,17H,5,10-12,14,16,18-20H2,1-4,6-9H3/b22-15+,23-17+ |
| InChIKey | BHOBSLAPASBZGM-YYZDAUDSSA-N |
| XLogP | 9.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.14 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|