C27H34O2 — CID 57091403
6,7-dimethyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)naphthalene-1,4-dione (PubChem CID 57091403) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 6,7-dimethyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)naphthalene-1,4-dione.
| Compound Name | 6,7-dimethyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 57091403 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 6,7-dimethyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)naphthalene-1,4-dione |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCC1=CC(=O)c2cc(C)c(C)cc2C1=O |
| InChI | InChI=1S/C27H34O2/c1-18(2)9-7-10-19(3)11-8-12-20(4)13-14-23-17-26(28)24-15-21(5)22(6)16-25(24)27(23)29/h9,11,13,15-17H,7-8,10,12,14H2,1-6H3 |
| InChIKey | VEQLDHILNFZSPH-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|