C29H47O4S+ — CID 163864021
[(2E,6E)-8-[3-carboxy-2-methoxy-6-[(2-methylpropan-2-yl)oxy]-4-pentylphenyl]-2,6-dimethylocta-2,6-dienyl]-dimethylsulfanium (PubChem CID 163864021) has the molecular formula C29H47O4S+ and a molecular weight of 491.76 g/mol. Its IUPAC name is [(2E,6E)-8-[3-carboxy-2-methoxy-6-[(2-methylpropan-2-yl)oxy]-4-pentylphenyl]-2,6-dimethylocta-2,6-dienyl]-dimethylsulfanium.
| Compound Name | [(2E,6E)-8-[3-carboxy-2-methoxy-6-[(2-methylpropan-2-yl)oxy]-4-pentylphenyl]-2,6-dimethylocta-2,6-dienyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 163864021 |
| Molecular Formula | C29H47O4S+ |
| Molecular Weight | 491.76 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | [(2E,6E)-8-[3-carboxy-2-methoxy-6-[(2-methylpropan-2-yl)oxy]-4-pentylphenyl]-2,6-dimethylocta-2,6-dienyl]-dimethylsulfanium |
| SMILES | CCCCCc1cc(OC(C)(C)C)c(C/C=C(\C)CC/C=C(\C)C[S+](C)C)c(OC)c1C(=O)O |
| InChI | InChI=1S/C29H46O4S/c1-10-11-12-16-23-19-25(33-29(4,5)6)24(27(32-7)26(23)28(30)31)18-17-21(2)14-13-15-22(3)20-34(8)9/h15,17,19H,10-14,16,18,20H2,1-9H3/p+1/b21-17+,22-15+ |
| InChIKey | PFBDYKNRIPRYBQ-BINFRMDJSA-O |
| XLogP | 7.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.76 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|