C21H25N3O — CID 155575315
6-(3-methylphenyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pentylphenol (PubChem CID 155575315) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 6-(3-methylphenyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pentylphenol.
| Compound Name | 6-(3-methylphenyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pentylphenol |
|---|---|
| PubChem CID | 155575315 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 6-(3-methylphenyl)-2-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pentylphenol |
| SMILES | CCCCCc1ccc(-c2cccc(C)c2)c(O)c1-c1n[nH]c(C)n1 |
| InChI | InChI=1S/C21H25N3O/c1-4-5-6-9-16-11-12-18(17-10-7-8-14(2)13-17)20(25)19(16)21-22-15(3)23-24-21/h7-8,10-13,25H,4-6,9H2,1-3H3,(H,22,23,24) |
| InChIKey | ZDBXHBLGPRRVGR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|