C34H52ClN4O9P — CID 167567204
N,N-diethylethanamine;(1-methylcyclopropyl)methyl (2S)-2-(chloroamino)propanoate;(1-methylcyclopropyl)methyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 167567204) has the molecular formula C34H52ClN4O9P and a molecular weight of 727.24 g/mol. Its IUPAC name is N,N-diethylethanamine;(1-methylcyclopropyl)methyl (2S)-2-(chloroamino)propanoate;(1-methylcyclopropyl)methyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | N,N-diethylethanamine;(1-methylcyclopropyl)methyl (2S)-2-(chloroamino)propanoate;(1-methylcyclopropyl)methyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 167567204 |
| Molecular Formula | C34H52ClN4O9P |
| Molecular Weight | 727.24 g/mol |
| Exact Mass | 726.32 |
| IUPAC Name | N,N-diethylethanamine;(1-methylcyclopropyl)methyl (2S)-2-(chloroamino)propanoate;(1-methylcyclopropyl)methyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCN(CC)CC.C[C@H](NCl)C(=O)OCC1(C)CC1.C[C@H](NP(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C(=O)OCC1(C)CC1 |
| InChI | InChI=1S/C20H23N2O7P.C8H14ClNO2.C6H15N/c1-15(19(23)27-14-20(2)12-13-20)21-30(26,28-17-6-4-3-5-7-17)29-18-10-8-16(9-11-18)22(24)25;1-6(10-9)7(11)12-5-8(2)3-4-8;1-4-7(5-2)6-3/h3-11,15H,12-14H2,1-2H3,(H,21,26);6,10H,3-5H2,1-2H3;4-6H2,1-3H3/t15-,30?;6-;/m00./s1 |
| InChIKey | FLBIFKZIZRUKDF-FPCWEUISSA-N |
| XLogP | 7.29 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.24 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|