C25H29F5NO5P — CID 166914432
(3,3-dimethylcyclobutyl) 2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate (PubChem CID 166914432) has the molecular formula C25H29F5NO5P and a molecular weight of 549.47 g/mol. Its IUPAC name is (3,3-dimethylcyclobutyl) 2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | (3,3-dimethylcyclobutyl) 2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166914432 |
| Molecular Formula | C25H29F5NO5P |
| Molecular Weight | 549.47 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (3,3-dimethylcyclobutyl) 2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(Oc1ccc(C(C)(C)C)cc1)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)OC1CC(C)(C)C1 |
| InChI | InChI=1S/C25H29F5NO5P/c1-13(23(32)34-16-11-25(5,6)12-16)31-37(33,35-15-9-7-14(8-10-15)24(2,3)4)36-22-20(29)18(27)17(26)19(28)21(22)30/h7-10,13,16H,11-12H2,1-6H3,(H,31,33) |
| InChIKey | IYOYSDQTZGFURQ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.47 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|