C36H53N2O8P — CID 171836038
[(3S)-oxolan-3-yl] (2S)-3-[4-[[(E)-5-hydroxy-4-methylpent-3-enyl]-[[(2S)-1-oxo-1-pentan-3-yloxypropan-2-yl]amino]phosphoryl]oxyphenyl]-2-(3-phenylpropylamino)propanoate (PubChem CID 171836038) has the molecular formula C36H53N2O8P and a molecular weight of 672.80 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] (2S)-3-[4-[[(E)-5-hydroxy-4-methylpent-3-enyl]-[[(2S)-1-oxo-1-pentan-3-yloxypropan-2-yl]amino]phosphoryl]oxyphenyl]-2-(3-phenylpropylamino)propanoate.
| Compound Name | [(3S)-oxolan-3-yl] (2S)-3-[4-[[(E)-5-hydroxy-4-methylpent-3-enyl]-[[(2S)-1-oxo-1-pentan-3-yloxypropan-2-yl]amino]phosphoryl]oxyphenyl]-2-(3-phenylpropylamino)propanoate |
|---|---|
| PubChem CID | 171836038 |
| Molecular Formula | C36H53N2O8P |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 672.35 |
| IUPAC Name | [(3S)-oxolan-3-yl] (2S)-3-[4-[[(E)-5-hydroxy-4-methylpent-3-enyl]-[[(2S)-1-oxo-1-pentan-3-yloxypropan-2-yl]amino]phosphoryl]oxyphenyl]-2-(3-phenylpropylamino)propanoate |
| SMILES | CCC(CC)OC(=O)[C@H](C)NP(=O)(CC/C=C(\C)CO)Oc1ccc(C[C@H](NCCCc2ccccc2)C(=O)O[C@H]2CCOC2)cc1 |
| InChI | InChI=1S/C36H53N2O8P/c1-5-31(6-2)44-35(40)28(4)38-47(42,23-11-12-27(3)25-39)46-32-18-16-30(17-19-32)24-34(36(41)45-33-20-22-43-26-33)37-21-10-15-29-13-8-7-9-14-29/h7-9,12-14,16-19,28,31,33-34,37,39H,5-6,10-11,15,20-26H2,1-4H3,(H,38,42)/b27-12+/t28-,33-,34-,47?/m0/s1 |
| InChIKey | FHRNUGWAXTXJRM-CPARBFMQSA-N |
| XLogP | 5.76 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|