C25H32N2O6 — CID 12011940
(3S)-3-[3-(4-ethoxyphenyl)propylamino]-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 12011940) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is (3S)-3-[3-(4-ethoxyphenyl)propylamino]-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[3-(4-ethoxyphenyl)propylamino]-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 12011940 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (3S)-3-[3-(4-ethoxyphenyl)propylamino]-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCOc1ccc(CCCN[C@@H](CC(=O)O)C(=O)N[C@@H](Cc2ccccc2)C(=O)OC)cc1 |
| InChI | InChI=1S/C25H32N2O6/c1-3-33-20-13-11-18(12-14-20)10-7-15-26-21(17-23(28)29)24(30)27-22(25(31)32-2)16-19-8-5-4-6-9-19/h4-6,8-9,11-14,21-22,26H,3,7,10,15-17H2,1-2H3,(H,27,30)(H,28,29)/t21-,22-/m0/s1 |
| InChIKey | GYPCPRKHKMEACJ-VXKWHMMOSA-N |
| XLogP | 2.35 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|