C25H32N2O6 — CID 70039973
(3S)-3-[3-(4-ethoxyphenyl)propylamino]-4-[2-[(1-methoxy-1-oxopropan-2-yl)amino]phenyl]-4-oxobutanoic acid (PubChem CID 70039973) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is (3S)-3-[3-(4-ethoxyphenyl)propylamino]-4-[2-[(1-methoxy-1-oxopropan-2-yl)amino]phenyl]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[3-(4-ethoxyphenyl)propylamino]-4-[2-[(1-methoxy-1-oxopropan-2-yl)amino]phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70039973 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (3S)-3-[3-(4-ethoxyphenyl)propylamino]-4-[2-[(1-methoxy-1-oxopropan-2-yl)amino]phenyl]-4-oxobutanoic acid |
| SMILES | CCOc1ccc(CCCN[C@@H](CC(=O)O)C(=O)c2ccccc2NC(C)C(=O)OC)cc1 |
| InChI | InChI=1S/C25H32N2O6/c1-4-33-19-13-11-18(12-14-19)8-7-15-26-22(16-23(28)29)24(30)20-9-5-6-10-21(20)27-17(2)25(31)32-3/h5-6,9-14,17,22,26-27H,4,7-8,15-16H2,1-3H3,(H,28,29)/t17?,22-/m0/s1 |
| InChIKey | AZXSFUFVLVIZLO-UGNFMNBCSA-N |
| XLogP | 3.31 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|