C24H30N2O6 — CID 69118364
(3S)-4-[2-[(1-methoxy-1-oxopropan-2-yl)amino]phenyl]-3-[3-(4-methoxyphenyl)propylamino]-4-oxobutanoic acid (PubChem CID 69118364) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is (3S)-4-[2-[(1-methoxy-1-oxopropan-2-yl)amino]phenyl]-3-[3-(4-methoxyphenyl)propylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[2-[(1-methoxy-1-oxopropan-2-yl)amino]phenyl]-3-[3-(4-methoxyphenyl)propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 69118364 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (3S)-4-[2-[(1-methoxy-1-oxopropan-2-yl)amino]phenyl]-3-[3-(4-methoxyphenyl)propylamino]-4-oxobutanoic acid |
| SMILES | COC(=O)C(C)Nc1ccccc1C(=O)[C@H](CC(=O)O)NCCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H30N2O6/c1-16(24(30)32-3)26-20-9-5-4-8-19(20)23(29)21(15-22(27)28)25-14-6-7-17-10-12-18(31-2)13-11-17/h4-5,8-13,16,21,25-26H,6-7,14-15H2,1-3H3,(H,27,28)/t16?,21-/m0/s1 |
| InChIKey | ZCEPXWRCXJEBPV-MRNPHLECSA-N |
| XLogP | 2.92 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|