C23H28N2O7 — CID 70026629
(3S)-3-[3-(4-hydroxy-3-methoxyphenyl)propylamino]-4-[2-[(2-methoxy-2-oxoethyl)amino]phenyl]-4-oxobutanoic acid (PubChem CID 70026629) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is (3S)-3-[3-(4-hydroxy-3-methoxyphenyl)propylamino]-4-[2-[(2-methoxy-2-oxoethyl)amino]phenyl]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[3-(4-hydroxy-3-methoxyphenyl)propylamino]-4-[2-[(2-methoxy-2-oxoethyl)amino]phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70026629 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (3S)-3-[3-(4-hydroxy-3-methoxyphenyl)propylamino]-4-[2-[(2-methoxy-2-oxoethyl)amino]phenyl]-4-oxobutanoic acid |
| SMILES | COC(=O)CNc1ccccc1C(=O)[C@H](CC(=O)O)NCCCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C23H28N2O7/c1-31-20-12-15(9-10-19(20)26)6-5-11-24-18(13-21(27)28)23(30)16-7-3-4-8-17(16)25-14-22(29)32-2/h3-4,7-10,12,18,24-26H,5-6,11,13-14H2,1-2H3,(H,27,28)/t18-/m0/s1 |
| InChIKey | FDCHRAXLLDPYGP-SFHVURJKSA-N |
| XLogP | 2.23 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|