C16H22N2O3 — CID 155534232
prop-2-enyl N-[4-oxo-4-(2-phenylethylamino)butyl]carbamate (PubChem CID 155534232) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is prop-2-enyl N-[4-oxo-4-(2-phenylethylamino)butyl]carbamate.
| Compound Name | prop-2-enyl N-[4-oxo-4-(2-phenylethylamino)butyl]carbamate |
|---|---|
| PubChem CID | 155534232 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | prop-2-enyl N-[4-oxo-4-(2-phenylethylamino)butyl]carbamate |
| SMILES | C=CCOC(=O)NCCCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C16H22N2O3/c1-2-13-21-16(20)18-11-6-9-15(19)17-12-10-14-7-4-3-5-8-14/h2-5,7-8H,1,6,9-13H2,(H,17,19)(H,18,20) |
| InChIKey | SVVQHERZJFXFDQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|