C31H34NO11P — CID 11786932
[(2R,3R)-3-acetyloxy-4-[acetyl(phenylmethoxy)amino]-1-bis(phenylmethoxy)phosphoryloxy-4-oxobutan-2-yl] acetate (PubChem CID 11786932) has the molecular formula C31H34NO11P and a molecular weight of 627.58 g/mol. Its IUPAC name is [(2R,3R)-3-acetyloxy-4-[acetyl(phenylmethoxy)amino]-1-bis(phenylmethoxy)phosphoryloxy-4-oxobutan-2-yl] acetate.
| Compound Name | [(2R,3R)-3-acetyloxy-4-[acetyl(phenylmethoxy)amino]-1-bis(phenylmethoxy)phosphoryloxy-4-oxobutan-2-yl] acetate |
|---|---|
| PubChem CID | 11786932 |
| Molecular Formula | C31H34NO11P |
| Molecular Weight | 627.58 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | [(2R,3R)-3-acetyloxy-4-[acetyl(phenylmethoxy)amino]-1-bis(phenylmethoxy)phosphoryloxy-4-oxobutan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](COP(=O)(OCc1ccccc1)OCc1ccccc1)[C@@H](OC(C)=O)C(=O)N(OCc1ccccc1)C(C)=O |
| InChI | InChI=1S/C31H34NO11P/c1-23(33)32(38-19-26-13-7-4-8-14-26)31(36)30(43-25(3)35)29(42-24(2)34)22-41-44(37,39-20-27-15-9-5-10-16-27)40-21-28-17-11-6-12-18-28/h4-18,29-30H,19-22H2,1-3H3/t29-,30-/m1/s1 |
| InChIKey | KWBXGZLAVCHNQR-LOYHVIPDSA-N |
| XLogP | 4.91 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|