C30H32O5 — CID 135011626
(1S,5R,6S,7R,8S)-1-ethenyl-6,7,8-tris(phenylmethoxy)-3,9-dioxabicyclo[3.3.1]nonane (PubChem CID 135011626) has the molecular formula C30H32O5 and a molecular weight of 472.58 g/mol. Its IUPAC name is (1S,5R,6S,7R,8S)-1-ethenyl-6,7,8-tris(phenylmethoxy)-3,9-dioxabicyclo[3.3.1]nonane.
| Compound Name | (1S,5R,6S,7R,8S)-1-ethenyl-6,7,8-tris(phenylmethoxy)-3,9-dioxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 135011626 |
| Molecular Formula | C30H32O5 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (1S,5R,6S,7R,8S)-1-ethenyl-6,7,8-tris(phenylmethoxy)-3,9-dioxabicyclo[3.3.1]nonane |
| SMILES | C=C[C@@]12COC[C@@H](O1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C30H32O5/c1-2-30-22-31-21-26(35-30)27(32-18-23-12-6-3-7-13-23)28(33-19-24-14-8-4-9-15-24)29(30)34-20-25-16-10-5-11-17-25/h2-17,26-29H,1,18-22H2/t26-,27+,28-,29+,30+/m1/s1 |
| InChIKey | BMNFBNHUUUUUFG-MYOTWTRRSA-N |
| XLogP | 5.10 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|