C25H39NO3 — CID 58982491
2',2'-diethyl-6',6'-dimethyl-1'-(1-phenylethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine] (PubChem CID 58982491) has the molecular formula C25H39NO3 and a molecular weight of 401.59 g/mol. Its IUPAC name is 2',2'-diethyl-6',6'-dimethyl-1'-(1-phenylethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine].
| Compound Name | 2',2'-diethyl-6',6'-dimethyl-1'-(1-phenylethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine] |
|---|---|
| PubChem CID | 58982491 |
| Molecular Formula | C25H39NO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | 2',2'-diethyl-6',6'-dimethyl-1'-(1-phenylethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine] |
| SMILES | CCC1(CC)CC2(CC(C)(C)N1OC(C)c1ccccc1)OC1CCCCC1O2 |
| InChI | InChI=1S/C25H39NO3/c1-6-24(7-2)18-25(27-21-15-11-12-16-22(21)28-25)17-23(4,5)26(24)29-19(3)20-13-9-8-10-14-20/h8-10,13-14,19,21-22H,6-7,11-12,15-18H2,1-5H3 |
| InChIKey | TWZXGLQVOJOBPO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |