C21H33NO2 — CID 71374560
2,2,6,6-tetraethyl-1-(1-phenylethoxy)piperidin-4-one (PubChem CID 71374560) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 2,2,6,6-tetraethyl-1-(1-phenylethoxy)piperidin-4-one.
| Compound Name | 2,2,6,6-tetraethyl-1-(1-phenylethoxy)piperidin-4-one |
|---|---|
| PubChem CID | 71374560 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 2,2,6,6-tetraethyl-1-(1-phenylethoxy)piperidin-4-one |
| SMILES | CCC1(CC)CC(=O)CC(CC)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C21H33NO2/c1-6-20(7-2)15-19(23)16-21(8-3,9-4)22(20)24-17(5)18-13-11-10-12-14-18/h10-14,17H,6-9,15-16H2,1-5H3 |
| InChIKey | XDNKFYXVAVAKEX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |