C30H51NO3 — CID 141020114
[2,6-diethyl-2,3,3-trimethyl-1-(1-phenylethoxy)piperidin-4-yl] decanoate (PubChem CID 141020114) has the molecular formula C30H51NO3 and a molecular weight of 473.74 g/mol. Its IUPAC name is [2,6-diethyl-2,3,3-trimethyl-1-(1-phenylethoxy)piperidin-4-yl] decanoate.
| Compound Name | [2,6-diethyl-2,3,3-trimethyl-1-(1-phenylethoxy)piperidin-4-yl] decanoate |
|---|---|
| PubChem CID | 141020114 |
| Molecular Formula | C30H51NO3 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.39 |
| IUPAC Name | [2,6-diethyl-2,3,3-trimethyl-1-(1-phenylethoxy)piperidin-4-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC1CC(CC)N(OC(C)c2ccccc2)C(C)(CC)C1(C)C |
| InChI | InChI=1S/C30H51NO3/c1-8-11-12-13-14-15-19-22-28(32)33-27-23-26(9-2)31(30(7,10-3)29(27,5)6)34-24(4)25-20-17-16-18-21-25/h16-18,20-21,24,26-27H,8-15,19,22-23H2,1-7H3 |
| InChIKey | VEWORUULOVVJDW-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|