C39H58N2O6 — CID 20512163
bis[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl] 2,2-dibenzylpropanedioate (PubChem CID 20512163) has the molecular formula C39H58N2O6 and a molecular weight of 650.90 g/mol. Its IUPAC name is bis[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl] 2,2-dibenzylpropanedioate.
| Compound Name | bis[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl] 2,2-dibenzylpropanedioate |
|---|---|
| PubChem CID | 20512163 |
| Molecular Formula | C39H58N2O6 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.43 |
| IUPAC Name | bis[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl] 2,2-dibenzylpropanedioate |
| SMILES | CC1(C)CC(OC(=O)C(Cc2ccccc2)(Cc2ccccc2)C(=O)OC2CC(C)(C)N(CCO)C(C)(C)C2)CC(C)(C)N1CCO |
| InChI | InChI=1S/C39H58N2O6/c1-35(2)25-31(26-36(3,4)40(35)19-21-42)46-33(44)39(23-29-15-11-9-12-16-29,24-30-17-13-10-14-18-30)34(45)47-32-27-37(5,6)41(20-22-43)38(7,8)28-32/h9-18,31-32,42-43H,19-28H2,1-8H3 |
| InChIKey | TZHRCDHNXIITCF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|