C16H19NO4-2 — CID 135393408
(2S,4S)-1-benzyl-2,4-diethylazetidine-2,4-dicarboxylate (PubChem CID 135393408) has the molecular formula C16H19NO4-2 and a molecular weight of 289.33 g/mol. Its IUPAC name is (2S,4S)-1-benzyl-2,4-diethylazetidine-2,4-dicarboxylate.
| Compound Name | (2S,4S)-1-benzyl-2,4-diethylazetidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 135393408 |
| Molecular Formula | C16H19NO4-2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2S,4S)-1-benzyl-2,4-diethylazetidine-2,4-dicarboxylate |
| SMILES | CC[C@@]1(C(=O)[O-])C[C@@](CC)(C(=O)[O-])N1Cc1ccccc1 |
| InChI | InChI=1S/C16H21NO4/c1-3-15(13(18)19)11-16(4-2,14(20)21)17(15)10-12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3,(H,18,19)(H,20,21)/p-2/t15-,16-/m0/s1 |
| InChIKey | PHMBCHSUWVVOMV-HOTGVXAUSA-L |
| XLogP | -0.31 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |