C21H24N2O2 — CID 101421866
2-benzoyl-1-benzyl-5,5-diethylpyrazolidin-3-one (PubChem CID 101421866) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-benzoyl-1-benzyl-5,5-diethylpyrazolidin-3-one.
| Compound Name | 2-benzoyl-1-benzyl-5,5-diethylpyrazolidin-3-one |
|---|---|
| PubChem CID | 101421866 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-benzoyl-1-benzyl-5,5-diethylpyrazolidin-3-one |
| SMILES | CCC1(CC)CC(=O)N(C(=O)c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H24N2O2/c1-3-21(4-2)15-19(24)23(20(25)18-13-9-6-10-14-18)22(21)16-17-11-7-5-8-12-17/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | WMAIJKABGHTIIQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|