C18H22N2O2 — CID 101428096
1-benzyl-2-(cyclopentene-1-carbonyl)-5,5-dimethylpyrazolidin-3-one (PubChem CID 101428096) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-benzyl-2-(cyclopentene-1-carbonyl)-5,5-dimethylpyrazolidin-3-one.
| Compound Name | 1-benzyl-2-(cyclopentene-1-carbonyl)-5,5-dimethylpyrazolidin-3-one |
|---|---|
| PubChem CID | 101428096 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-benzyl-2-(cyclopentene-1-carbonyl)-5,5-dimethylpyrazolidin-3-one |
| SMILES | CC1(C)CC(=O)N(C(=O)C2=CCCC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H22N2O2/c1-18(2)12-16(21)20(17(22)15-10-6-7-11-15)19(18)13-14-8-4-3-5-9-14/h3-5,8-10H,6-7,11-13H2,1-2H3 |
| InChIKey | BIRGUNCCPYHPFT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|