C18H19NO — CID 101178309
[(2S)-1-benzyl-3,3-dimethylaziridin-2-yl]-phenylmethanone (PubChem CID 101178309) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is [(2S)-1-benzyl-3,3-dimethylaziridin-2-yl]-phenylmethanone.
| Compound Name | [(2S)-1-benzyl-3,3-dimethylaziridin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101178309 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | [(2S)-1-benzyl-3,3-dimethylaziridin-2-yl]-phenylmethanone |
| SMILES | CC1(C)[C@@H](C(=O)c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-18(2)17(16(20)15-11-7-4-8-12-15)19(18)13-14-9-5-3-6-10-14/h3-12,17H,13H2,1-2H3/t17-,19?/m1/s1 |
| InChIKey | OFJQYBSDBQVEPL-DUSLRRAJSA-N |
| XLogP | 3.53 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|