C20H19NO3 — CID 102325570
(3R,4S)-3-benzoyl-1-benzyl-4-ethylpyrrolidine-2,5-dione (PubChem CID 102325570) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (3R,4S)-3-benzoyl-1-benzyl-4-ethylpyrrolidine-2,5-dione.
| Compound Name | (3R,4S)-3-benzoyl-1-benzyl-4-ethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 102325570 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (3R,4S)-3-benzoyl-1-benzyl-4-ethylpyrrolidine-2,5-dione |
| SMILES | CC[C@@H]1C(=O)N(Cc2ccccc2)C(=O)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO3/c1-2-16-17(18(22)15-11-7-4-8-12-15)20(24)21(19(16)23)13-14-9-5-3-6-10-14/h3-12,16-17H,2,13H2,1H3/t16-,17+/m0/s1 |
| InChIKey | PGLSUBHNJBYRHD-DLBZAZTESA-N |
| XLogP | 3.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|