C14H17N3O4Pt — CID 42633210
2-azanidylethylazanide;1-benzylazetidine-3,3-dicarboxylate;platinum(4+) (PubChem CID 42633210) has the molecular formula C14H17N3O4Pt and a molecular weight of 486.39 g/mol. Its IUPAC name is 2-azanidylethylazanide;1-benzylazetidine-3,3-dicarboxylate;platinum(4+).
| Compound Name | 2-azanidylethylazanide;1-benzylazetidine-3,3-dicarboxylate;platinum(4+) |
|---|---|
| PubChem CID | 42633210 |
| Molecular Formula | C14H17N3O4Pt |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 2-azanidylethylazanide;1-benzylazetidine-3,3-dicarboxylate;platinum(4+) |
| SMILES | O=C([O-])C1(C(=O)[O-])CN(Cc2ccccc2)C1.[NH-]CC[NH-].[Pt+4] |
| InChI | InChI=1S/C12H13NO4.C2H6N2.Pt/c14-10(15)12(11(16)17)7-13(8-12)6-9-4-2-1-3-5-9;3-1-2-4;/h1-5H,6-8H2,(H,14,15)(H,16,17);3-4H,1-2H2;/q;-2;+4/p-2 |
| InChIKey | ZJJIOZSNJDWJAR-UHFFFAOYSA-L |
| XLogP | -0.92 |
| TPSA | 131.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|