C12H18N2O4 — CID 129179319
4-benzyl-1-methylpiperazine-2,2,6,6-tetrol (PubChem CID 129179319) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-benzyl-1-methylpiperazine-2,2,6,6-tetrol.
| Compound Name | 4-benzyl-1-methylpiperazine-2,2,6,6-tetrol |
|---|---|
| PubChem CID | 129179319 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4-benzyl-1-methylpiperazine-2,2,6,6-tetrol |
| SMILES | CN1C(O)(O)CN(Cc2ccccc2)CC1(O)O |
| InChI | InChI=1S/C12H18N2O4/c1-13-11(15,16)8-14(9-12(13,17)18)7-10-5-3-2-4-6-10/h2-6,15-18H,7-9H2,1H3 |
| InChIKey | JYEUXBUFLNFFCB-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|