C11H12ClF4N — CID 22645922
1-benzyl-3,3,4,4-tetrafluoropyrrolidine;hydrochloride (PubChem CID 22645922) has the molecular formula C11H12ClF4N and a molecular weight of 269.67 g/mol. Its IUPAC name is 1-benzyl-3,3,4,4-tetrafluoropyrrolidine;hydrochloride.
| Compound Name | 1-benzyl-3,3,4,4-tetrafluoropyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 22645922 |
| Molecular Formula | C11H12ClF4N |
| Molecular Weight | 269.67 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 1-benzyl-3,3,4,4-tetrafluoropyrrolidine;hydrochloride |
| SMILES | Cl.FC1(F)CN(Cc2ccccc2)CC1(F)F |
| InChI | InChI=1S/C11H11F4N.ClH/c12-10(13)7-16(8-11(10,14)15)6-9-4-2-1-3-5-9;/h1-5H,6-8H2;1H |
| InChIKey | ROCXKOFXIYTVTM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|