C18H19F2NO — CID 97357069
(4R)-1-benzyl-3,3-difluoro-4-phenylpiperidin-4-ol (PubChem CID 97357069) has the molecular formula C18H19F2NO and a molecular weight of 303.35 g/mol. Its IUPAC name is (4R)-1-benzyl-3,3-difluoro-4-phenylpiperidin-4-ol.
| Compound Name | (4R)-1-benzyl-3,3-difluoro-4-phenylpiperidin-4-ol |
|---|---|
| PubChem CID | 97357069 |
| Molecular Formula | C18H19F2NO |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (4R)-1-benzyl-3,3-difluoro-4-phenylpiperidin-4-ol |
| SMILES | O[C@@]1(c2ccccc2)CCN(Cc2ccccc2)CC1(F)F |
| InChI | InChI=1S/C18H19F2NO/c19-18(20)14-21(13-15-7-3-1-4-8-15)12-11-17(18,22)16-9-5-2-6-10-16/h1-10,22H,11-14H2/t17-/m1/s1 |
| InChIKey | PRUKFHVVPGNJJV-QGZVFWFLSA-N |
| XLogP | 3.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |