C12H26NO4P — CID 69301568
(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) dihydrogen phosphate (PubChem CID 69301568) has the molecular formula C12H26NO4P and a molecular weight of 279.32 g/mol. Its IUPAC name is (2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) dihydrogen phosphate.
| Compound Name | (2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 69301568 |
| Molecular Formula | C12H26NO4P |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) dihydrogen phosphate |
| SMILES | CCCN1C(C)(C)CC(OP(=O)(O)O)CC1(C)C |
| InChI | InChI=1S/C12H26NO4P/c1-6-7-13-11(2,3)8-10(9-12(13,4)5)17-18(14,15)16/h10H,6-9H2,1-5H3,(H2,14,15,16) |
| InChIKey | ILCPPHSPYANRAL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|