C26H49N2O6+ — CID 176948895
[4-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonyl-2-methylhexanoyl]oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium (PubChem CID 176948895) has the molecular formula C26H49N2O6+ and a molecular weight of 485.69 g/mol. Its IUPAC name is [4-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonyl-2-methylhexanoyl]oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium.
| Compound Name | [4-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonyl-2-methylhexanoyl]oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
|---|---|
| PubChem CID | 176948895 |
| Molecular Formula | C26H49N2O6+ |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.36 |
| IUPAC Name | [4-[2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonyl-2-methylhexanoyl]oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
| SMILES | CCCCC(C)(C(=O)OC1CC(C)(C)N(O)C(C)(C)C1)C(=O)OC1CC(C)(C)N([OH2+])C(C)(C)C1 |
| InChI | InChI=1S/C26H48N2O6/c1-11-12-13-26(10,20(29)33-18-14-22(2,3)27(31)23(4,5)15-18)21(30)34-19-16-24(6,7)28(32)25(8,9)17-19/h18-19,31-32H,11-17H2,1-10H3/p+1 |
| InChIKey | VMLZKMITBNMZHP-UHFFFAOYSA-O |
| XLogP | 4.34 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|