C56H105N3O12 — CID 139514330
tris[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl] 12-methylhexadecane-4,4,11-tricarboxylate (PubChem CID 139514330) has the molecular formula C56H105N3O12 and a molecular weight of 1012.46 g/mol. Its IUPAC name is tris[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl] 12-methylhexadecane-4,4,11-tricarboxylate.
| Compound Name | tris[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl] 12-methylhexadecane-4,4,11-tricarboxylate |
|---|---|
| PubChem CID | 139514330 |
| Molecular Formula | C56H105N3O12 |
| Molecular Weight | 1012.46 g/mol |
| Exact Mass | 1011.77 |
| IUPAC Name | tris[3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl] 12-methylhexadecane-4,4,11-tricarboxylate |
| SMILES | CCCCC(C)(CCCCCCC(CCCC)(C(=O)OCCCOC1CC(C)(C)N(O)C(C)(C)C1)C(=O)OCCCOC1CC(C)(C)N(O)C(C)(C)C1)C(=O)OCCCOC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C56H105N3O12/c1-16-18-27-55(15,46(60)69-34-24-31-66-43-37-49(3,4)57(63)50(5,6)38-43)28-22-20-21-23-30-56(29-19-17-2,47(61)70-35-25-32-67-44-39-51(7,8)58(64)52(9,10)40-44)48(62)71-36-26-33-68-45-41-53(11,12)59(65)54(13,14)42-45/h43-45,63-65H,16-42H2,1-15H3 |
| InChIKey | DYLGKRPZABHSAN-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.46 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|