C108H186N6O24 — CID 140891553
CID 140891553 (PubChem CID 140891553) has the molecular formula C108H186N6O24 and a molecular weight of 1952.69 g/mol.
| Compound Name | CID 140891553 |
|---|---|
| PubChem CID | 140891553 |
| Molecular Formula | C108H186N6O24 |
| Molecular Weight | 1952.69 g/mol |
| Exact Mass | 1951.35 |
| IUPAC Name | — |
| SMILES | CCCCC(CCCc1cc(CCCC(CCCC)(C(=O)OCCCOC2CC(C)(C)N([O])C(C)(C)C2)C(=O)OCCCOC2CC(C)(C)N([O])C(C)(C)C2)cc(CCCC(CCCC)(C(=O)OCCCOC2CC(C)(C)N([O])C(C)(C)C2)C(=O)OCCCOC2CC(C)(C)N([O])C(C)(C)C2)c1)(C(=O)OCCCOC1CC(C)(C)N([O])C(C)(C)C1)C(=O)OCCCOC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C108H186N6O24/c1-28-31-46-106(88(115)133-58-37-52-127-82-67-94(4,5)109(121)95(6,7)68-82,89(116)134-59-38-53-128-83-69-96(8,9)110(122)97(10,11)70-83)49-34-43-79-64-80(44-35-50-107(47-32-29-2,90(117)135-60-39-54-129-84-71-98(12,13)111(123)99(14,15)72-84)91(118)136-61-40-55-130-85-73-100(16,17)112(124)101(18,19)74-85)66-81(65-79)45-36-51-108(48-33-30-3,92(119)137-62-41-56-131-86-75-102(20,21)113(125)103(22,23)76-86)93(120)138-63-42-57-132-87-77-104(24,25)114(126)105(26,27)78-87/h64-66,82-87H,28-63,67-78H2,1-27H3 |
| InChIKey | MOJMDJOAERGOPD-UHFFFAOYSA-N |
| XLogP | 20.09 |
| TPSA | 352.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 57 |
| Heavy Atoms | 138 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1952.69 |
| LogP ≤ 5 | 20.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|