C32H61IN2O6 — CID 153368732
1-O-[3-[4-methyl-4-(methylamino)pentan-2-yl]oxypropyl] 3-O-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl] 2-butyl-2-(3-iodopropyl)propanedioate (PubChem CID 153368732) has the molecular formula C32H61IN2O6 and a molecular weight of 696.75 g/mol. Its IUPAC name is 1-O-[3-[4-methyl-4-(methylamino)pentan-2-yl]oxypropyl] 3-O-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl] 2-butyl-2-(3-iodopropyl)propanedioate.
| Compound Name | 1-O-[3-[4-methyl-4-(methylamino)pentan-2-yl]oxypropyl] 3-O-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl] 2-butyl-2-(3-iodopropyl)propanedioate |
|---|---|
| PubChem CID | 153368732 |
| Molecular Formula | C32H61IN2O6 |
| Molecular Weight | 696.75 g/mol |
| Exact Mass | 696.36 |
| IUPAC Name | 1-O-[3-[4-methyl-4-(methylamino)pentan-2-yl]oxypropyl] 3-O-[3-(2,2,6,6-tetramethylpiperidin-4-yl)oxypropyl] 2-butyl-2-(3-iodopropyl)propanedioate |
| SMILES | CCCCC(CCCI)(C(=O)OCCCOC(C)CC(C)(C)NC)C(=O)OCCCOC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C32H61IN2O6/c1-10-11-15-32(16-12-17-33,27(36)40-20-13-18-38-25(2)22-29(3,4)34-9)28(37)41-21-14-19-39-26-23-30(5,6)35-31(7,8)24-26/h25-26,34-35H,10-24H2,1-9H3 |
| InChIKey | SBUQAOMQSVBNOV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.75 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|