C35H64N2O2 — CID 134238678
N-tert-butyl-4-[4-[3-ethyl-4-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutyl]phenyl]butoxy]-2-methylpentan-2-amine (PubChem CID 134238678) has the molecular formula C35H64N2O2 and a molecular weight of 544.91 g/mol. Its IUPAC name is N-tert-butyl-4-[4-[3-ethyl-4-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutyl]phenyl]butoxy]-2-methylpentan-2-amine.
| Compound Name | N-tert-butyl-4-[4-[3-ethyl-4-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutyl]phenyl]butoxy]-2-methylpentan-2-amine |
|---|---|
| PubChem CID | 134238678 |
| Molecular Formula | C35H64N2O2 |
| Molecular Weight | 544.91 g/mol |
| Exact Mass | 544.50 |
| IUPAC Name | N-tert-butyl-4-[4-[3-ethyl-4-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxybutyl]phenyl]butoxy]-2-methylpentan-2-amine |
| SMILES | CCc1cc(CCCCOC(C)CC(C)(C)NC(C)(C)C)ccc1CCCCOC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C35H64N2O2/c1-12-29-23-28(17-13-15-21-38-27(2)24-33(6,7)36-32(3,4)5)19-20-30(29)18-14-16-22-39-31-25-34(8,9)37-35(10,11)26-31/h19-20,23,27,31,36-37H,12-18,21-22,24-26H2,1-11H3 |
| InChIKey | IFEOJRYMKZQLBZ-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.91 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|