C90H146N6O18 — CID 170936784
CID 170936784 (PubChem CID 170936784) has the molecular formula C90H146N6O18 and a molecular weight of 1600.18 g/mol.
| Compound Name | CID 170936784 |
|---|---|
| PubChem CID | 170936784 |
| Molecular Formula | C90H146N6O18 |
| Molecular Weight | 1600.18 g/mol |
| Exact Mass | 1599.07 |
| IUPAC Name | — |
| SMILES | CCCCC(CCCc1ccc(CCCC(CCCC)(C(=O)OC2CC(C)(C)N([O])C(C)(C)C2)C(=O)OC2CC3(CC3)N([O])C3(CC3)C2)c(CCCC(CCCC)(C(=O)OC2CC(C)(C)N([O])C(C)(C)C2)C(=O)OC2CC(C)(C)N([O])C(C)(C)C2)c1)(C(=O)OC1CC(C)(C)N([O])C(C)(C)C1)C(=O)OC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C90H146N6O18/c1-24-27-38-88(70(97)109-64-49-76(4,5)91(103)77(6,7)50-64,71(98)110-65-51-78(8,9)92(104)79(10,11)52-65)41-30-33-61-36-37-62(34-31-42-89(39-28-25-2,72(99)111-66-53-80(12,13)93(105)81(14,15)54-66)75(102)114-69-59-86(44-45-86)96(108)87(60-69)46-47-87)63(48-61)35-32-43-90(40-29-26-3,73(100)112-67-55-82(16,17)94(106)83(18,19)56-67)74(101)113-68-57-84(20,21)95(107)85(22,23)58-68/h36-37,48,64-69H,24-35,38-47,49-60H2,1-23H3 |
| InChIKey | UIHMSEOUYOLJES-UHFFFAOYSA-N |
| XLogP | 17.15 |
| TPSA | 296.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 114 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1600.18 |
| LogP ≤ 5 | 17.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|