About 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate
3-methylsulfonylpropyl 3-amino-4-fluorobenzoate (PubChem CID 63191963) has the molecular formula C11H14FNO4S
and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate.
Molecular Properties
| Compound Name | 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate |
| PubChem CID | 63191963 |
| Molecular Formula | C11H14FNO4S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate |
| SMILES | CS(=O)(=O)CCCOC(=O)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C11H14FNO4S/c1-18(15,16)6-2-5-17-11(14)8-3-4-9(12)10(13)7-8/h3-4,7H,2,5-6,13H2,1H3 |
| InChIKey | QHSONOXRAARMPS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate?
The IUPAC name of 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate (CID 63191963) is 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate.
What is the SMILES notation for 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate?
The canonical SMILES for 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate is CS(=O)(=O)CCCOC(=O)c1ccc(F)c(N)c1.
What is the InChIKey of 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate?
The InChIKey is QHSONOXRAARMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO4S/c1-18(15,16)6-2-5-17-11(14)8-3-4-9(12)10(13)7-8/h3-4,7H,2,5-6,13H2,1H3.
What are the key properties of 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate?
3-methylsulfonylpropyl 3-amino-4-fluorobenzoate has a molecular weight of 275.30 g/mol, XLogP of 1.00, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfonylpropyl 3-amino-4-fluorobenzoate is sourced from PubChem (CID 63191963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).