C13H16N2O4 — CID 61321191
[2-(cyclopropylamino)-2-oxoethyl] 5-amino-2-methoxybenzoate (PubChem CID 61321191) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 5-amino-2-methoxybenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 5-amino-2-methoxybenzoate |
|---|---|
| PubChem CID | 61321191 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 5-amino-2-methoxybenzoate |
| SMILES | COc1ccc(N)cc1C(=O)OCC(=O)NC1CC1 |
| InChI | InChI=1S/C13H16N2O4/c1-18-11-5-2-8(14)6-10(11)13(17)19-7-12(16)15-9-3-4-9/h2,5-6,9H,3-4,7,14H2,1H3,(H,15,16) |
| InChIKey | KETKJGJDDRQWIH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|