C13H17N3O3 — CID 62628318
[3-(cyclopropylamino)-3-oxopropyl] 2,4-diaminobenzoate (PubChem CID 62628318) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is [3-(cyclopropylamino)-3-oxopropyl] 2,4-diaminobenzoate.
| Compound Name | [3-(cyclopropylamino)-3-oxopropyl] 2,4-diaminobenzoate |
|---|---|
| PubChem CID | 62628318 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [3-(cyclopropylamino)-3-oxopropyl] 2,4-diaminobenzoate |
| SMILES | Nc1ccc(C(=O)OCCC(=O)NC2CC2)c(N)c1 |
| InChI | InChI=1S/C13H17N3O3/c14-8-1-4-10(11(15)7-8)13(18)19-6-5-12(17)16-9-2-3-9/h1,4,7,9H,2-3,5-6,14-15H2,(H,16,17) |
| InChIKey | WSKISJLVIJMKGU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|