C15H10BrNO2S2 — CID 55704837
(5-bromothiophen-3-yl)methyl 2-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 55704837) has the molecular formula C15H10BrNO2S2 and a molecular weight of 380.29 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)methyl 2-phenyl-1,3-thiazole-4-carboxylate.
| Compound Name | (5-bromothiophen-3-yl)methyl 2-phenyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 55704837 |
| Molecular Formula | C15H10BrNO2S2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 378.93 |
| IUPAC Name | (5-bromothiophen-3-yl)methyl 2-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | O=C(OCc1csc(Br)c1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H10BrNO2S2/c16-13-6-10(8-20-13)7-19-15(18)12-9-21-14(17-12)11-4-2-1-3-5-11/h1-6,8-9H,7H2 |
| InChIKey | JEHUFURVUMNSOG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |