C17H20N2O4S2 — CID 98284648
N-[[(2R)-oxan-2-yl]methylsulfonyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide (PubChem CID 98284648) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[[(2R)-oxan-2-yl]methylsulfonyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[[(2R)-oxan-2-yl]methylsulfonyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 98284648 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[[(2R)-oxan-2-yl]methylsulfonyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2ccccc2)n1)NS(=O)(=O)C[C@H]1CCCCO1 |
| InChI | InChI=1S/C17H20N2O4S2/c20-16(19-25(21,22)12-15-8-4-5-9-23-15)10-14-11-24-17(18-14)13-6-2-1-3-7-13/h1-3,6-7,11,15H,4-5,8-10,12H2,(H,19,20)/t15-/m1/s1 |
| InChIKey | YGDCUTSNSDRHHT-OAHLLOKOSA-N |
| XLogP | 2.37 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |