C11H14ClNO5S — CID 134813247
5-chloro-N-(oxan-2-ylmethylsulfonyl)furan-2-carboxamide (PubChem CID 134813247) has the molecular formula C11H14ClNO5S and a molecular weight of 307.75 g/mol. Its IUPAC name is 5-chloro-N-(oxan-2-ylmethylsulfonyl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(oxan-2-ylmethylsulfonyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 134813247 |
| Molecular Formula | C11H14ClNO5S |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 5-chloro-N-(oxan-2-ylmethylsulfonyl)furan-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)CC1CCCCO1)c1ccc(Cl)o1 |
| InChI | InChI=1S/C11H14ClNO5S/c12-10-5-4-9(18-10)11(14)13-19(15,16)7-8-3-1-2-6-17-8/h4-5,8H,1-3,6-7H2,(H,13,14) |
| InChIKey | UYMZFUSBGDKMEX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |