C11H14BrNO4S2 — CID 136532717
5-bromo-4-methyl-N-(oxolan-2-ylmethylsulfonyl)thiophene-3-carboxamide (PubChem CID 136532717) has the molecular formula C11H14BrNO4S2 and a molecular weight of 368.27 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(oxolan-2-ylmethylsulfonyl)thiophene-3-carboxamide.
| Compound Name | 5-bromo-4-methyl-N-(oxolan-2-ylmethylsulfonyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 136532717 |
| Molecular Formula | C11H14BrNO4S2 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | 5-bromo-4-methyl-N-(oxolan-2-ylmethylsulfonyl)thiophene-3-carboxamide |
| SMILES | Cc1c(C(=O)NS(=O)(=O)CC2CCCO2)csc1Br |
| InChI | InChI=1S/C11H14BrNO4S2/c1-7-9(5-18-10(7)12)11(14)13-19(15,16)6-8-3-2-4-17-8/h5,8H,2-4,6H2,1H3,(H,13,14) |
| InChIKey | XMXWAUFUSWEHNA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |