C11H15NO5S2 — CID 55174697
methyl 3-(oxolan-2-ylmethylsulfonylamino)thiophene-2-carboxylate (PubChem CID 55174697) has the molecular formula C11H15NO5S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is methyl 3-(oxolan-2-ylmethylsulfonylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-(oxolan-2-ylmethylsulfonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 55174697 |
| Molecular Formula | C11H15NO5S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | methyl 3-(oxolan-2-ylmethylsulfonylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NS(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C11H15NO5S2/c1-16-11(13)10-9(4-6-18-10)12-19(14,15)7-8-3-2-5-17-8/h4,6,8,12H,2-3,5,7H2,1H3 |
| InChIKey | XLXFRTOFAIARFT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |