C15H21NO6S — CID 119034438
methyl 3-methoxy-2-(oxan-2-ylmethylsulfonylamino)benzoate (PubChem CID 119034438) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is methyl 3-methoxy-2-(oxan-2-ylmethylsulfonylamino)benzoate.
| Compound Name | methyl 3-methoxy-2-(oxan-2-ylmethylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 119034438 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | methyl 3-methoxy-2-(oxan-2-ylmethylsulfonylamino)benzoate |
| SMILES | COC(=O)c1cccc(OC)c1NS(=O)(=O)CC1CCCCO1 |
| InChI | InChI=1S/C15H21NO6S/c1-20-13-8-5-7-12(15(17)21-2)14(13)16-23(18,19)10-11-6-3-4-9-22-11/h5,7-8,11,16H,3-4,6,9-10H2,1-2H3 |
| InChIKey | ONTLRPYHTOSOLN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |