C17H20FN3O4S — CID 138045332
1-(3-fluorophenyl)-3-methyl-N-(oxan-2-ylmethylsulfonyl)pyrazole-4-carboxamide (PubChem CID 138045332) has the molecular formula C17H20FN3O4S and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-methyl-N-(oxan-2-ylmethylsulfonyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-3-methyl-N-(oxan-2-ylmethylsulfonyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138045332 |
| Molecular Formula | C17H20FN3O4S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-(3-fluorophenyl)-3-methyl-N-(oxan-2-ylmethylsulfonyl)pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2cccc(F)c2)cc1C(=O)NS(=O)(=O)CC1CCCCO1 |
| InChI | InChI=1S/C17H20FN3O4S/c1-12-16(10-21(19-12)14-6-4-5-13(18)9-14)17(22)20-26(23,24)11-15-7-2-3-8-25-15/h4-6,9-10,15H,2-3,7-8,11H2,1H3,(H,20,22) |
| InChIKey | QMRAVYGCZNRWSX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |