C11H19N3O3S — CID 154840984
N-(1,5-dimethylpyrazol-3-yl)-1-(oxan-2-yl)methanesulfonamide (PubChem CID 154840984) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-3-yl)-1-(oxan-2-yl)methanesulfonamide.
| Compound Name | N-(1,5-dimethylpyrazol-3-yl)-1-(oxan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 154840984 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(1,5-dimethylpyrazol-3-yl)-1-(oxan-2-yl)methanesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)CC2CCCCO2)nn1C |
| InChI | InChI=1S/C11H19N3O3S/c1-9-7-11(12-14(9)2)13-18(15,16)8-10-5-3-4-6-17-10/h7,10H,3-6,8H2,1-2H3,(H,12,13) |
| InChIKey | LZSLCSUZGQVLLC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |