C14H19N3O3S2 — CID 75425369
N-[5-(3-methylthiophen-2-yl)-1H-pyrazol-3-yl]-1-(oxan-2-yl)methanesulfonamide (PubChem CID 75425369) has the molecular formula C14H19N3O3S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[5-(3-methylthiophen-2-yl)-1H-pyrazol-3-yl]-1-(oxan-2-yl)methanesulfonamide.
| Compound Name | N-[5-(3-methylthiophen-2-yl)-1H-pyrazol-3-yl]-1-(oxan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 75425369 |
| Molecular Formula | C14H19N3O3S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-[5-(3-methylthiophen-2-yl)-1H-pyrazol-3-yl]-1-(oxan-2-yl)methanesulfonamide |
| SMILES | Cc1ccsc1-c1cc(NS(=O)(=O)CC2CCCCO2)n[nH]1 |
| InChI | InChI=1S/C14H19N3O3S2/c1-10-5-7-21-14(10)12-8-13(16-15-12)17-22(18,19)9-11-4-2-3-6-20-11/h5,7-8,11H,2-4,6,9H2,1H3,(H2,15,16,17) |
| InChIKey | GLYARABHCPVNCD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |